About 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one
4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one (PubChem CID 89229286) has the molecular formula C18H9F4NO2
and a molecular weight of 347.27 g/mol. Its IUPAC name is 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one |
| PubChem CID | 89229286 |
| Molecular Formula | C18H9F4NO2 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one |
| SMILES | C#Cc1c(=O)[nH]c(OCc2c(F)cc(F)cc2F)c2cc(F)ccc12 |
| InChI | InChI=1S/C18H9F4NO2/c1-2-11-12-4-3-9(19)5-13(12)18(23-17(11)24)25-8-14-15(21)6-10(20)7-16(14)22/h1,3-7H,8H2,(H,23,24) |
| InChIKey | LWBKUFYNFPQCPI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one?
The IUPAC name of 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one (CID 89229286) is 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one.
What is the SMILES notation for 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one?
The canonical SMILES for 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one is C#Cc1c(=O)[nH]c(OCc2c(F)cc(F)cc2F)c2cc(F)ccc12.
What is the InChIKey of 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one?
The InChIKey is LWBKUFYNFPQCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F4NO2/c1-2-11-12-4-3-9(19)5-13(12)18(23-17(11)24)25-8-14-15(21)6-10(20)7-16(14)22/h1,3-7H,8H2,(H,23,24).
What are the key properties of 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one?
4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one has a molecular weight of 347.27 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-7-fluoro-1-[(2,4,6-trifluorophenyl)methoxy]-2H-isoquinolin-3-one is sourced from PubChem (CID 89229286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).