C24H26F3N3O2S — CID 89229322
2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methylphenyl]-N'-hydroxyethanimidamide (PubChem CID 89229322) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methylphenyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methylphenyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 89229322 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[4-[[4-butyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]-2-methylphenyl]-N'-hydroxyethanimidamide |
| SMILES | CCCCc1nc(-c2ccc(C(F)(F)F)cc2)sc1COc1ccc(C/C(N)=N/O)c(C)c1 |
| InChI | InChI=1S/C24H26F3N3O2S/c1-3-4-5-20-21(14-32-19-11-8-17(15(2)12-19)13-22(28)30-31)33-23(29-20)16-6-9-18(10-7-16)24(25,26)27/h6-12,31H,3-5,13-14H2,1-2H3,(H2,28,30) |
| InChIKey | ZWYUQVQGWTXNDX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|