About indazolo[3,2-c][1,2,4]benzotriazin-2-amine
indazolo[3,2-c][1,2,4]benzotriazin-2-amine (PubChem CID 89229338) has the molecular formula C13H9N5
and a molecular weight of 235.25 g/mol. Its IUPAC name is indazolo[3,2-c][1,2,4]benzotriazin-2-amine.
Molecular Properties
| Compound Name | indazolo[3,2-c][1,2,4]benzotriazin-2-amine |
| PubChem CID | 89229338 |
| Molecular Formula | C13H9N5 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | indazolo[3,2-c][1,2,4]benzotriazin-2-amine |
| SMILES | Nc1ccc2nnc3c4ccccc4nn3c2c1 |
| InChI | InChI=1S/C13H9N5/c14-8-5-6-11-12(7-8)18-13(16-15-11)9-3-1-2-4-10(9)17-18/h1-7H,14H2 |
| InChIKey | OZQDQVUHLAZYLE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze indazolo[3,2-c][1,2,4]benzotriazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indazolo[3,2-c][1,2,4]benzotriazin-2-amine?
The IUPAC name of indazolo[3,2-c][1,2,4]benzotriazin-2-amine (CID 89229338) is indazolo[3,2-c][1,2,4]benzotriazin-2-amine.
What is the SMILES notation for indazolo[3,2-c][1,2,4]benzotriazin-2-amine?
The canonical SMILES for indazolo[3,2-c][1,2,4]benzotriazin-2-amine is Nc1ccc2nnc3c4ccccc4nn3c2c1.
What is the InChIKey of indazolo[3,2-c][1,2,4]benzotriazin-2-amine?
The InChIKey is OZQDQVUHLAZYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5/c14-8-5-6-11-12(7-8)18-13(16-15-11)9-3-1-2-4-10(9)17-18/h1-7H,14H2.
What are the key properties of indazolo[3,2-c][1,2,4]benzotriazin-2-amine?
indazolo[3,2-c][1,2,4]benzotriazin-2-amine has a molecular weight of 235.25 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for indazolo[3,2-c][1,2,4]benzotriazin-2-amine is sourced from PubChem (CID 89229338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).