About N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine
N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine (PubChem CID 89229664) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine.
Molecular Properties
| Compound Name | N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine |
| PubChem CID | 89229664 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine |
| SMILES | C/N=C/C1(C)C=C(C)C2C(C)CC21 |
| InChI | InChI=1S/C12H19N/c1-8-5-10-11(8)9(2)6-12(10,3)7-13-4/h6-8,10-11H,5H2,1-4H3/b13-7+ |
| InChIKey | OGRDUAYWCYJUPK-NTUHNPAUSA-N |
| XLogP | 2.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine?
The IUPAC name of N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine (CID 89229664) is N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine.
What is the SMILES notation for N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine?
The canonical SMILES for N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine is C/N=C/C1(C)C=C(C)C2C(C)CC21.
What is the InChIKey of N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine?
The InChIKey is OGRDUAYWCYJUPK-NTUHNPAUSA-N. The full InChI is InChI=1S/C12H19N/c1-8-5-10-11(8)9(2)6-12(10,3)7-13-4/h6-8,10-11H,5H2,1-4H3/b13-7+.
What are the key properties of N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine?
N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine has a molecular weight of 177.29 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2,4,6-trimethyl-2-bicyclo[3.2.0]hept-3-enyl)methanimine is sourced from PubChem (CID 89229664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).