C11H17N3O — CID 89229687
3-[(3Z,5Z)-6-amino-4-ethenylhexa-1,3,5-trien-2-yl]-1,1-dimethylurea (PubChem CID 89229687) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-[(3Z,5Z)-6-amino-4-ethenylhexa-1,3,5-trien-2-yl]-1,1-dimethylurea.
| Compound Name | 3-[(3Z,5Z)-6-amino-4-ethenylhexa-1,3,5-trien-2-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 89229687 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[(3Z,5Z)-6-amino-4-ethenylhexa-1,3,5-trien-2-yl]-1,1-dimethylurea |
| SMILES | C=CC(/C=C\N)=C/C(=C)NC(=O)N(C)C |
| InChI | InChI=1S/C11H17N3O/c1-5-10(6-7-12)8-9(2)13-11(15)14(3)4/h5-8H,1-2,12H2,3-4H3,(H,13,15)/b7-6-,10-8- |
| InChIKey | AIDFSFIDMGKFAP-INZNQPOWSA-N |
| XLogP | 1.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|