C18H31NO6 — CID 89229771
ethyl 2-[1-[2-[[(2S,3S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enyl]piperidin-4-yl]acetate (PubChem CID 89229771) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 2-[1-[2-[[(2S,3S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enyl]piperidin-4-yl]acetate.
| Compound Name | ethyl 2-[1-[2-[[(2S,3S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 89229771 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | ethyl 2-[1-[2-[[(2S,3S)-3,4,5-trihydroxyoxan-2-yl]methyl]prop-2-enyl]piperidin-4-yl]acetate |
| SMILES | C=C(C[C@@H]1OCC(O)C(O)[C@@H]1O)CN1CCC(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C18H31NO6/c1-3-24-16(21)9-13-4-6-19(7-5-13)10-12(2)8-15-18(23)17(22)14(20)11-25-15/h13-15,17-18,20,22-23H,2-11H2,1H3/t14?,15-,17?,18+/m0/s1 |
| InChIKey | BZSSSRFHOUAUEE-QZOMQWOVSA-N |
| XLogP | 0.08 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|