C13H18O — CID 89229948
2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-1,3-diene (PubChem CID 89229948) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-1,3-diene.
| Compound Name | 2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89229948 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxycyclohexa-1,3-diene |
| SMILES | C/C=C\C=C(/CC)OC1=CCCC=C1 |
| InChI | InChI=1S/C13H18O/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h3,5,7,9-11H,4,6,8H2,1-2H3/b5-3-,12-9+ |
| InChIKey | QYRHDCIMKZOXKW-FNNBZGKSSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|