C11H17NO3 — CID 89230086
3-hydroxy-2-methoxy-4,7-dimethyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 89230086) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-hydroxy-2-methoxy-4,7-dimethyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 3-hydroxy-2-methoxy-4,7-dimethyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 89230086 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-hydroxy-2-methoxy-4,7-dimethyl-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CON1C(=O)C2C(C)C=CC(C)C2C1O |
| InChI | InChI=1S/C11H17NO3/c1-6-4-5-7(2)9-8(6)10(13)12(15-3)11(9)14/h4-10,13H,1-3H3 |
| InChIKey | LBFILWZPZASXGM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|