C12H14Cl2FN3O2 — CID 89230131
N-[(2,4-dichloro-6-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide (PubChem CID 89230131) has the molecular formula C12H14Cl2FN3O2 and a molecular weight of 322.17 g/mol. Its IUPAC name is N-[(2,4-dichloro-6-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide.
| Compound Name | N-[(2,4-dichloro-6-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 89230131 |
| Molecular Formula | C12H14Cl2FN3O2 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(2,4-dichloro-6-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
| SMILES | CN1C(=O)NCC1C(=O)NCC1=C(Cl)CC(Cl)C=C1F |
| InChI | InChI=1S/C12H14Cl2FN3O2/c1-18-10(5-17-12(18)20)11(19)16-4-7-8(14)2-6(13)3-9(7)15/h3,6,10H,2,4-5H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | RLTIWHGASBCTHJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|