C13H17Cl2N3O2 — CID 89230192
N-[(4,6-dichloro-2-methylcyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide (PubChem CID 89230192) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is N-[(4,6-dichloro-2-methylcyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide.
| Compound Name | N-[(4,6-dichloro-2-methylcyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 89230192 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[(4,6-dichloro-2-methylcyclohexa-1,5-dien-1-yl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
| SMILES | CC1=C(CNC(=O)C2CNC(=O)N2C)C(Cl)=CC(Cl)C1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-7-3-8(14)4-10(15)9(7)5-16-12(19)11-6-17-13(20)18(11)2/h4,8,11H,3,5-6H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | KFEZYZBSVAVHHZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|