C22H21N5O2 — CID 89230210
2-[5-[3-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide (PubChem CID 89230210) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[5-[3-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide.
| Compound Name | 2-[5-[3-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 89230210 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[5-[3-(4-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]-2-hydroxy-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C(O)c1cncc(-c2cnc3[nH]cc(-c4ccc(N)cc4)c3c2)c1 |
| InChI | InChI=1S/C22H21N5O2/c1-27(2)22(29)20(28)16-7-14(9-24-10-16)15-8-18-19(12-26-21(18)25-11-15)13-3-5-17(23)6-4-13/h3-12,20,28H,23H2,1-2H3,(H,25,26) |
| InChIKey | GXMHIQQLWGCQQA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|