About (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol
(E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol (PubChem CID 89230402) has the molecular formula C9H12OS
and a molecular weight of 168.26 g/mol. Its IUPAC name is (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol.
Molecular Properties
| Compound Name | (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol |
| PubChem CID | 89230402 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol |
| SMILES | COC1=CC=C(/C=C/S)CC1 |
| InChI | InChI=1S/C9H12OS/c1-10-9-4-2-8(3-5-9)6-7-11/h2,4,6-7,11H,3,5H2,1H3/b7-6+ |
| InChIKey | LQQPBKJQAPLMAI-VOTSOKGWSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol?
The IUPAC name of (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol (CID 89230402) is (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol.
What is the SMILES notation for (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol?
The canonical SMILES for (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol is COC1=CC=C(/C=C/S)CC1.
What is the InChIKey of (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol?
The InChIKey is LQQPBKJQAPLMAI-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H12OS/c1-10-9-4-2-8(3-5-9)6-7-11/h2,4,6-7,11H,3,5H2,1H3/b7-6+.
What are the key properties of (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol?
(E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol has a molecular weight of 168.26 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(4-methoxycyclohexa-1,3-dien-1-yl)ethenethiol is sourced from PubChem (CID 89230402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).