About ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate
ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate (PubChem CID 892310) has the molecular formula C16H23N3O2S
and a molecular weight of 321.45 g/mol. Its IUPAC name is ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate |
| PubChem CID | 892310 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)Nc2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-4-21-16(20)19-9-7-18(8-10-19)15(22)17-14-6-5-12(2)11-13(14)3/h5-6,11H,4,7-10H2,1-3H3,(H,17,22) |
| InChIKey | SSHYMNQWPUOJJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate (CID 892310) is ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=S)Nc2ccc(C)cc2C)CC1.
What is the InChIKey of ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate?
The InChIKey is SSHYMNQWPUOJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2S/c1-4-21-16(20)19-9-7-18(8-10-19)15(22)17-14-6-5-12(2)11-13(14)3/h5-6,11H,4,7-10H2,1-3H3,(H,17,22).
What are the key properties of ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate?
ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate has a molecular weight of 321.45 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2,4-dimethylphenyl)carbamothioyl]piperazine-1-carboxylate is sourced from PubChem (CID 892310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).