C18H24BrN5 — CID 89231366
1-N-[(3E,4Z)-6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-(aminomethylidene)-3-prop-2-enylidene-2-pyridinyl]-3-bromopropane-1,2-diamine (PubChem CID 89231366) has the molecular formula C18H24BrN5 and a molecular weight of 390.33 g/mol. Its IUPAC name is 1-N-[(3E,4Z)-6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-(aminomethylidene)-3-prop-2-enylidene-2-pyridinyl]-3-bromopropane-1,2-diamine.
| Compound Name | 1-N-[(3E,4Z)-6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-(aminomethylidene)-3-prop-2-enylidene-2-pyridinyl]-3-bromopropane-1,2-diamine |
|---|---|
| PubChem CID | 89231366 |
| Molecular Formula | C18H24BrN5 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-N-[(3E,4Z)-6-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-4-(aminomethylidene)-3-prop-2-enylidene-2-pyridinyl]-3-bromopropane-1,2-diamine |
| SMILES | C=C/C=C(\C=C/N)c1cc(=C/N)/c(=C\C=C)c(NCC(N)CBr)n1 |
| InChI | InChI=1S/C18H24BrN5/c1-3-5-13(7-8-20)17-9-14(11-21)16(6-4-2)18(24-17)23-12-15(22)10-19/h3-9,11,15H,1-2,10,12,20-22H2,(H,23,24)/b8-7-,13-5+,14-11-,16-6+ |
| InChIKey | YBMCWBNAGQLJTC-OKSVQFFRSA-N |
| XLogP | 0.92 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|