About (4R)-2,4-dimethyl-3-propoxyoxolane
(4R)-2,4-dimethyl-3-propoxyoxolane (PubChem CID 89231419) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (4R)-2,4-dimethyl-3-propoxyoxolane.
Molecular Properties
| Compound Name | (4R)-2,4-dimethyl-3-propoxyoxolane |
| PubChem CID | 89231419 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (4R)-2,4-dimethyl-3-propoxyoxolane |
| SMILES | CCCOC1C(C)OC[C@H]1C |
| InChI | InChI=1S/C9H18O2/c1-4-5-10-9-7(2)6-11-8(9)3/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m1/s1 |
| InChIKey | FDNJBQLPQPHLGP-AFPNSQJFSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2,4-dimethyl-3-propoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,4-dimethyl-3-propoxyoxolane?
The IUPAC name of (4R)-2,4-dimethyl-3-propoxyoxolane (CID 89231419) is (4R)-2,4-dimethyl-3-propoxyoxolane.
What is the SMILES notation for (4R)-2,4-dimethyl-3-propoxyoxolane?
The canonical SMILES for (4R)-2,4-dimethyl-3-propoxyoxolane is CCCOC1C(C)OC[C@H]1C.
What is the InChIKey of (4R)-2,4-dimethyl-3-propoxyoxolane?
The InChIKey is FDNJBQLPQPHLGP-AFPNSQJFSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-5-10-9-7(2)6-11-8(9)3/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m1/s1.
What are the key properties of (4R)-2,4-dimethyl-3-propoxyoxolane?
(4R)-2,4-dimethyl-3-propoxyoxolane has a molecular weight of 158.24 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,4-dimethyl-3-propoxyoxolane is sourced from PubChem (CID 89231419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).