C17H20FN5O2 — CID 89231503
3-fluoro-4-[[5-(morpholin-4-ylmethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-4-yl]oxy]aniline (PubChem CID 89231503) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-fluoro-4-[[5-(morpholin-4-ylmethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-4-yl]oxy]aniline.
| Compound Name | 3-fluoro-4-[[5-(morpholin-4-ylmethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-4-yl]oxy]aniline |
|---|---|
| PubChem CID | 89231503 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-fluoro-4-[[5-(morpholin-4-ylmethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-4-yl]oxy]aniline |
| SMILES | Nc1ccc(OC2=NC=NN3CCC(CN4CCOCC4)=C23)c(F)c1 |
| InChI | InChI=1S/C17H20FN5O2/c18-14-9-13(19)1-2-15(14)25-17-16-12(3-4-23(16)21-11-20-17)10-22-5-7-24-8-6-22/h1-2,9,11H,3-8,10,19H2 |
| InChIKey | ODVRKZZIIDVQBQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|