About 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole
4,5-bis(ethenylidene)-2-methyl-1,3-thiazole (PubChem CID 89231608) has the molecular formula C8H7NS
and a molecular weight of 149.22 g/mol. Its IUPAC name is 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole |
| PubChem CID | 89231608 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole |
| SMILES | C=C=c1nc(C)sc1=C=C |
| InChI | InChI=1S/C8H7NS/c1-4-7-8(5-2)10-6(3)9-7/h1-2H2,3H3 |
| InChIKey | OZVRYSUNANGNDO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole?
The IUPAC name of 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole (CID 89231608) is 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole.
What is the SMILES notation for 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole?
The canonical SMILES for 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole is C=C=c1nc(C)sc1=C=C.
What is the InChIKey of 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole?
The InChIKey is OZVRYSUNANGNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS/c1-4-7-8(5-2)10-6(3)9-7/h1-2H2,3H3.
What are the key properties of 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole?
4,5-bis(ethenylidene)-2-methyl-1,3-thiazole has a molecular weight of 149.22 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenylidene)-2-methyl-1,3-thiazole is sourced from PubChem (CID 89231608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).