C31H38FN3O4 — CID 89231611
(12S)-12-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione (PubChem CID 89231611) has the molecular formula C31H38FN3O4 and a molecular weight of 535.66 g/mol. Its IUPAC name is (12S)-12-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione.
| Compound Name | (12S)-12-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione |
|---|---|
| PubChem CID | 89231611 |
| Molecular Formula | C31H38FN3O4 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (12S)-12-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione |
| SMILES | C#CCC1NC(=O)CCCCOc2ccc(cc2F)C[C@@H]([C@H](O)CNC2(c3cccc(CC)c3)CC2)NC1=O |
| InChI | InChI=1S/C31H38FN3O4/c1-3-8-25-30(38)35-26(27(36)20-33-31(14-15-31)23-10-7-9-21(4-2)17-23)19-22-12-13-28(24(32)18-22)39-16-6-5-11-29(37)34-25/h1,7,9-10,12-13,17-18,25-27,33,36H,4-6,8,11,14-16,19-20H2,2H3,(H,34,37)(H,35,38)/t25?,26-,27+/m0/s1 |
| InChIKey | RWVOUWDHNKFGSH-GDRMZMBQSA-N |
| XLogP | 3.13 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|