C27H23N3O7 — CID 89231703
(2Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]penta-2,4-dienoic acid (PubChem CID 89231703) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is (2Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]penta-2,4-dienoic acid.
| Compound Name | (2Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 89231703 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | (2Z)-4-[[2-[(19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl)oxy]-2-oxoethyl]amino]penta-2,4-dienoic acid |
| SMILES | C=C(/C=C\C(=O)O)NCC(=O)OC1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C27H23N3O7/c1-3-27(37-23(33)12-28-15(2)8-9-22(31)32)19-11-21-24-17(10-16-6-4-5-7-20(16)29-24)13-30(21)25(34)18(19)14-36-26(27)35/h4-11,28H,2-3,12-14H2,1H3,(H,31,32)/b9-8- |
| InChIKey | USFVDUBTPYQTHU-HJWRWDBZSA-N |
| XLogP | 2.37 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|