C22H29ClN4O4S2 — CID 89231713
(2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methoxy-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 89231713) has the molecular formula C22H29ClN4O4S2 and a molecular weight of 513.09 g/mol. Its IUPAC name is (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methoxy-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methoxy-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89231713 |
| Molecular Formula | C22H29ClN4O4S2 |
| Molecular Weight | 513.09 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (2S,4R)-4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-N-methoxy-N-methyl-1-(6-methyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1C[C@@H](NC(=O)C2CC=C(Cl)S2)CN1C(=O)c1cc2c(s1)CCN(C)CC2 |
| InChI | InChI=1S/C22H29ClN4O4S2/c1-25-8-6-13-10-18(32-16(13)7-9-25)22(30)27-12-14(11-15(27)21(29)26(2)31-3)24-20(28)17-4-5-19(23)33-17/h5,10,14-15,17H,4,6-9,11-12H2,1-3H3,(H,24,28)/t14-,15+,17?/m1/s1 |
| InChIKey | BJKOSHTTWZPFGV-CKDQBVIESA-N |
| XLogP | 2.08 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|