C22H27N5O2S — CID 89231906
4-amino-N-methyl-N-[4-(1,8-naphthyridin-2-ylmethylamino)cyclohexyl]benzenesulfonamide (PubChem CID 89231906) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[4-(1,8-naphthyridin-2-ylmethylamino)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-N-[4-(1,8-naphthyridin-2-ylmethylamino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89231906 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-amino-N-methyl-N-[4-(1,8-naphthyridin-2-ylmethylamino)cyclohexyl]benzenesulfonamide |
| SMILES | CN(C1CCC(NCc2ccc3cccnc3n2)CC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H27N5O2S/c1-27(30(28,29)21-12-5-17(23)6-13-21)20-10-8-18(9-11-20)25-15-19-7-4-16-3-2-14-24-22(16)26-19/h2-7,12-14,18,20,25H,8-11,15,23H2,1H3 |
| InChIKey | RZTZDUXCTRJJET-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|