About 6-hydrazinylcyclohexa-2,3,5-trien-1-amine
6-hydrazinylcyclohexa-2,3,5-trien-1-amine (PubChem CID 89231931) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 6-hydrazinylcyclohexa-2,3,5-trien-1-amine.
Molecular Properties
| Compound Name | 6-hydrazinylcyclohexa-2,3,5-trien-1-amine |
| PubChem CID | 89231931 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 6-hydrazinylcyclohexa-2,3,5-trien-1-amine |
| SMILES | NNC1=CC=C=CC1N |
| InChI | InChI=1S/C6H9N3/c7-5-3-1-2-4-6(5)9-8/h2-5,9H,7-8H2 |
| InChIKey | WLQSQQDMACOZPV-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinylcyclohexa-2,3,5-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinylcyclohexa-2,3,5-trien-1-amine?
The IUPAC name of 6-hydrazinylcyclohexa-2,3,5-trien-1-amine (CID 89231931) is 6-hydrazinylcyclohexa-2,3,5-trien-1-amine.
What is the SMILES notation for 6-hydrazinylcyclohexa-2,3,5-trien-1-amine?
The canonical SMILES for 6-hydrazinylcyclohexa-2,3,5-trien-1-amine is NNC1=CC=C=CC1N.
What is the InChIKey of 6-hydrazinylcyclohexa-2,3,5-trien-1-amine?
The InChIKey is WLQSQQDMACOZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c7-5-3-1-2-4-6(5)9-8/h2-5,9H,7-8H2.
What are the key properties of 6-hydrazinylcyclohexa-2,3,5-trien-1-amine?
6-hydrazinylcyclohexa-2,3,5-trien-1-amine has a molecular weight of 123.16 g/mol, XLogP of -0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinylcyclohexa-2,3,5-trien-1-amine is sourced from PubChem (CID 89231931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).