C44H43BN2O2 — CID 89232618
9-[3-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-2,4-dien-1-yl]carbazole (PubChem CID 89232618) has the molecular formula C44H43BN2O2 and a molecular weight of 642.65 g/mol. Its IUPAC name is 9-[3-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-2,4-dien-1-yl]carbazole.
| Compound Name | 9-[3-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-2,4-dien-1-yl]carbazole |
|---|---|
| PubChem CID | 89232618 |
| Molecular Formula | C44H43BN2O2 |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | 9-[3-[3-ethenyl-2-[(Z)-prop-1-enyl]indol-1-yl]-1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclohexa-2,4-dien-1-yl]carbazole |
| SMILES | C=Cc1c(/C=C\C)n(C2=CC(C)(n3c4ccccc4c4ccccc43)CC(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)=C2)c2ccccc12 |
| InChI | InChI=1S/C44H43BN2O2/c1-8-16-38-34(9-2)35-17-10-13-20-39(35)46(38)33-27-31(30-23-25-32(26-24-30)45-48-42(3,4)43(5,6)49-45)28-44(7,29-33)47-40-21-14-11-18-36(40)37-19-12-15-22-41(37)47/h8-27,29H,2,28H2,1,3-7H3/b16-8- |
| InChIKey | VUGWFLUQSNZZIA-PXNMLYILSA-N |
| XLogP | 10.47 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|