About [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol
[(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol (PubChem CID 89232720) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol |
| PubChem CID | 89232720 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol |
| SMILES | NCc1cccc2c1O[C@@H](CO)CC2 |
| InChI | InChI=1S/C11H15NO2/c12-6-9-3-1-2-8-4-5-10(7-13)14-11(8)9/h1-3,10,13H,4-7,12H2/t10-/m1/s1 |
| InChIKey | XOZNPNZEYNZIAK-SNVBAGLBSA-N |
| XLogP | 0.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol?
The IUPAC name of [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol (CID 89232720) is [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol.
What is the SMILES notation for [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol?
The canonical SMILES for [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol is NCc1cccc2c1O[C@@H](CO)CC2.
What is the InChIKey of [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol?
The InChIKey is XOZNPNZEYNZIAK-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H15NO2/c12-6-9-3-1-2-8-4-5-10(7-13)14-11(8)9/h1-3,10,13H,4-7,12H2/t10-/m1/s1.
What are the key properties of [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol?
[(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol has a molecular weight of 193.25 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-8-(aminomethyl)-3,4-dihydro-2H-chromen-2-yl]methanol is sourced from PubChem (CID 89232720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).