About (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane
(2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane (PubChem CID 89232851) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane.
Molecular Properties
| Compound Name | (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane |
| PubChem CID | 89232851 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane |
| SMILES | Cc1ccc(-c2ccccc2[C@@H](C)OC[C@H]2CO2)cc1C |
| InChI | InChI=1S/C19H22O2/c1-13-8-9-16(10-14(13)2)19-7-5-4-6-18(19)15(3)20-11-17-12-21-17/h4-10,15,17H,11-12H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | ICQDGOIBPPLSLF-WBVHZDCISA-N |
| XLogP | 4.45 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane?
The IUPAC name of (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane (CID 89232851) is (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane.
What is the SMILES notation for (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane?
The canonical SMILES for (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane is Cc1ccc(-c2ccccc2[C@@H](C)OC[C@H]2CO2)cc1C.
What is the InChIKey of (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane?
The InChIKey is ICQDGOIBPPLSLF-WBVHZDCISA-N. The full InChI is InChI=1S/C19H22O2/c1-13-8-9-16(10-14(13)2)19-7-5-4-6-18(19)15(3)20-11-17-12-21-17/h4-10,15,17H,11-12H2,1-3H3/t15-,17+/m1/s1.
What are the key properties of (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane?
(2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane has a molecular weight of 282.38 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[(1R)-1-[2-(3,4-dimethylphenyl)phenyl]ethoxy]methyl]oxirane is sourced from PubChem (CID 89232851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).