About 5-methyl-3-nitroso-1H-1,2,4-triazole
5-methyl-3-nitroso-1H-1,2,4-triazole (PubChem CID 89233076) has the molecular formula C3H4N4O
and a molecular weight of 112.09 g/mol. Its IUPAC name is 5-methyl-3-nitroso-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-methyl-3-nitroso-1H-1,2,4-triazole |
| PubChem CID | 89233076 |
| Molecular Formula | C3H4N4O |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.04 |
| IUPAC Name | 5-methyl-3-nitroso-1H-1,2,4-triazole |
| SMILES | Cc1nc(N=O)n[nH]1 |
| InChI | InChI=1S/C3H4N4O/c1-2-4-3(7-8)6-5-2/h1H3,(H,4,5,6) |
| InChIKey | ONQKYDGSHMRVTM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-nitroso-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-nitroso-1H-1,2,4-triazole?
The IUPAC name of 5-methyl-3-nitroso-1H-1,2,4-triazole (CID 89233076) is 5-methyl-3-nitroso-1H-1,2,4-triazole.
What is the SMILES notation for 5-methyl-3-nitroso-1H-1,2,4-triazole?
The canonical SMILES for 5-methyl-3-nitroso-1H-1,2,4-triazole is Cc1nc(N=O)n[nH]1.
What is the InChIKey of 5-methyl-3-nitroso-1H-1,2,4-triazole?
The InChIKey is ONQKYDGSHMRVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O/c1-2-4-3(7-8)6-5-2/h1H3,(H,4,5,6).
What are the key properties of 5-methyl-3-nitroso-1H-1,2,4-triazole?
5-methyl-3-nitroso-1H-1,2,4-triazole has a molecular weight of 112.09 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-nitroso-1H-1,2,4-triazole is sourced from PubChem (CID 89233076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).