About (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol
(Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol (PubChem CID 89233107) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol.
Molecular Properties
| Compound Name | (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol |
| PubChem CID | 89233107 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol |
| SMILES | C/C=C(\C=C/CO)CCC(C)(C)C |
| InChI | InChI=1S/C12H22O/c1-5-11(7-6-10-13)8-9-12(2,3)4/h5-7,13H,8-10H2,1-4H3/b7-6-,11-5+ |
| InChIKey | CMDALUBACCTDSY-TUKAJDRUSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol?
The IUPAC name of (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol (CID 89233107) is (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol.
What is the SMILES notation for (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol?
The canonical SMILES for (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol is C/C=C(\C=C/CO)CCC(C)(C)C.
What is the InChIKey of (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol?
The InChIKey is CMDALUBACCTDSY-TUKAJDRUSA-N. The full InChI is InChI=1S/C12H22O/c1-5-11(7-6-10-13)8-9-12(2,3)4/h5-7,13H,8-10H2,1-4H3/b7-6-,11-5+.
What are the key properties of (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol?
(Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol has a molecular weight of 182.31 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4Z)-4-ethylidene-7,7-dimethyloct-2-en-1-ol is sourced from PubChem (CID 89233107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).