C25H30FN5O3 — CID 89233111
5-fluoro-3-[[4-[[(2S,5E,6E)-6-hydrazinylidene-5-prop-2-enylidene-1,4-dioxan-2-yl]methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one (PubChem CID 89233111) has the molecular formula C25H30FN5O3 and a molecular weight of 467.55 g/mol. Its IUPAC name is 5-fluoro-3-[[4-[[(2S,5E,6E)-6-hydrazinylidene-5-prop-2-enylidene-1,4-dioxan-2-yl]methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one.
| Compound Name | 5-fluoro-3-[[4-[[(2S,5E,6E)-6-hydrazinylidene-5-prop-2-enylidene-1,4-dioxan-2-yl]methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one |
|---|---|
| PubChem CID | 89233111 |
| Molecular Formula | C25H30FN5O3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 5-fluoro-3-[[4-[[(2S,5E,6E)-6-hydrazinylidene-5-prop-2-enylidene-1,4-dioxan-2-yl]methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-11-one |
| SMILES | C=C/C=C1/OC[C@H](CNC2CCN(CC3Cn4c(=O)ccc5ccc(F)c3c54)CC2)O/C1=N/N |
| InChI | InChI=1S/C25H30FN5O3/c1-2-3-21-25(29-27)34-19(15-33-21)12-28-18-8-10-30(11-9-18)13-17-14-31-22(32)7-5-16-4-6-20(26)23(17)24(16)31/h2-7,17-19,28H,1,8-15,27H2/b21-3+,29-25+/t17?,19-/m0/s1 |
| InChIKey | SDIDRVDWORNBNC-LCNTWAALSA-N |
| XLogP | 2.05 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|