C10H20N2 — CID 89233222
N-buta-1,3-dien-2-yl-N',N'-diethylethane-1,2-diamine (PubChem CID 89233222) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-buta-1,3-dien-2-yl-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 89233222 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N',N'-diethylethane-1,2-diamine |
| SMILES | C=CC(=C)NCCN(CC)CC |
| InChI | InChI=1S/C10H20N2/c1-5-10(4)11-8-9-12(6-2)7-3/h5,11H,1,4,6-9H2,2-3H3 |
| InChIKey | CXRITYZUNWQTEC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|