C19H20BNO3 — CID 89233230
3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxy-9-methylcarbazole (PubChem CID 89233230) has the molecular formula C19H20BNO3 and a molecular weight of 321.19 g/mol. Its IUPAC name is 3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxy-9-methylcarbazole.
| Compound Name | 3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxy-9-methylcarbazole |
|---|---|
| PubChem CID | 89233230 |
| Molecular Formula | C19H20BNO3 |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-2-methoxy-9-methylcarbazole |
| SMILES | C=C1OB(c2cc3c4ccccc4n(C)c3cc2OC)OC1(C)C |
| InChI | InChI=1S/C19H20BNO3/c1-12-19(2,3)24-20(23-12)15-10-14-13-8-6-7-9-16(13)21(4)17(14)11-18(15)22-5/h6-11H,1H2,2-5H3 |
| InChIKey | MAODAEXYFANFKE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|