C15H29F3 — CID 89233447
3,6-diethyl-4,4,5-trifluoro-3,5,6-trimethyloctane (PubChem CID 89233447) has the molecular formula C15H29F3 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3,6-diethyl-4,4,5-trifluoro-3,5,6-trimethyloctane.
| Compound Name | 3,6-diethyl-4,4,5-trifluoro-3,5,6-trimethyloctane |
|---|---|
| PubChem CID | 89233447 |
| Molecular Formula | C15H29F3 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3,6-diethyl-4,4,5-trifluoro-3,5,6-trimethyloctane |
| SMILES | CCC(C)(CC)C(C)(F)C(F)(F)C(C)(CC)CC |
| InChI | InChI=1S/C15H29F3/c1-8-12(5,9-2)14(7,16)15(17,18)13(6,10-3)11-4/h8-11H2,1-7H3 |
| InChIKey | CIKLLLKCYBMWGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |