About (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene
(6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene (PubChem CID 89233480) has the molecular formula C11H13FS
and a molecular weight of 196.29 g/mol. Its IUPAC name is (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene.
Molecular Properties
| Compound Name | (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene |
| PubChem CID | 89233480 |
| Molecular Formula | C11H13FS |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene |
| SMILES | Cc1csc2c1=CC[C@](C)(CF)C=2 |
| InChI | InChI=1S/C11H13FS/c1-8-6-13-10-5-11(2,7-12)4-3-9(8)10/h3,5-6H,4,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | AVAFWEFSBADOJO-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene?
The IUPAC name of (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene (CID 89233480) is (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene.
What is the SMILES notation for (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene?
The canonical SMILES for (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene is Cc1csc2c1=CC[C@](C)(CF)C=2.
What is the InChIKey of (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene?
The InChIKey is AVAFWEFSBADOJO-NSHDSACASA-N. The full InChI is InChI=1S/C11H13FS/c1-8-6-13-10-5-11(2,7-12)4-3-9(8)10/h3,5-6H,4,7H2,1-2H3/t11-/m0/s1.
What are the key properties of (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene?
(6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene has a molecular weight of 196.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(fluoromethyl)-3,6-dimethyl-5H-1-benzothiophene is sourced from PubChem (CID 89233480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).