C13H25F3 — CID 89233545
4,4,5-trifluoro-3,3,5,6,6-pentamethyloctane (PubChem CID 89233545) has the molecular formula C13H25F3 and a molecular weight of 238.34 g/mol. Its IUPAC name is 4,4,5-trifluoro-3,3,5,6,6-pentamethyloctane.
| Compound Name | 4,4,5-trifluoro-3,3,5,6,6-pentamethyloctane |
|---|---|
| PubChem CID | 89233545 |
| Molecular Formula | C13H25F3 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4,4,5-trifluoro-3,3,5,6,6-pentamethyloctane |
| SMILES | CCC(C)(C)C(C)(F)C(F)(F)C(C)(C)CC |
| InChI | InChI=1S/C13H25F3/c1-8-10(3,4)12(7,14)13(15,16)11(5,6)9-2/h8-9H2,1-7H3 |
| InChIKey | IPHNXEUBMCTEMJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |