C5HBr2F9O — CID 89233684
1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropane (PubChem CID 89233684) has the molecular formula C5HBr2F9O and a molecular weight of 407.85 g/mol. Its IUPAC name is 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 89233684 |
| Molecular Formula | C5HBr2F9O |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 405.83 |
| IUPAC Name | 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropane |
| SMILES | FC(C(F)(F)F)C(F)(F)OC(F)(Br)C(F)(F)Br |
| InChI | InChI=1S/C5HBr2F9O/c6-4(14,15)5(7,16)17-3(12,13)1(8)2(9,10)11/h1H |
| InChIKey | OPSDNQLIUUQOKE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|