C18H36O2 — CID 89233746
4-tert-butyl-2-ethoxy-2,4,6,6-tetramethyloctan-3-one (PubChem CID 89233746) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 4-tert-butyl-2-ethoxy-2,4,6,6-tetramethyloctan-3-one.
| Compound Name | 4-tert-butyl-2-ethoxy-2,4,6,6-tetramethyloctan-3-one |
|---|---|
| PubChem CID | 89233746 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 4-tert-butyl-2-ethoxy-2,4,6,6-tetramethyloctan-3-one |
| SMILES | CCOC(C)(C)C(=O)C(C)(CC(C)(C)CC)C(C)(C)C |
| InChI | InChI=1S/C18H36O2/c1-11-16(6,7)13-18(10,15(3,4)5)14(19)17(8,9)20-12-2/h11-13H2,1-10H3 |
| InChIKey | DCIBGAFQWZBFFK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |