About 7,8-dimethylnon-8-enal
7,8-dimethylnon-8-enal (PubChem CID 89233841) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 7,8-dimethylnon-8-enal.
Molecular Properties
| Compound Name | 7,8-dimethylnon-8-enal |
| PubChem CID | 89233841 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 7,8-dimethylnon-8-enal |
| SMILES | C=C(C)C(C)CCCCCC=O |
| InChI | InChI=1S/C11H20O/c1-10(2)11(3)8-6-4-5-7-9-12/h9,11H,1,4-8H2,2-3H3 |
| InChIKey | JILQTCJXFZUDHZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethylnon-8-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethylnon-8-enal?
The IUPAC name of 7,8-dimethylnon-8-enal (CID 89233841) is 7,8-dimethylnon-8-enal.
What is the SMILES notation for 7,8-dimethylnon-8-enal?
The canonical SMILES for 7,8-dimethylnon-8-enal is C=C(C)C(C)CCCCCC=O.
What is the InChIKey of 7,8-dimethylnon-8-enal?
The InChIKey is JILQTCJXFZUDHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-10(2)11(3)8-6-4-5-7-9-12/h9,11H,1,4-8H2,2-3H3.
What are the key properties of 7,8-dimethylnon-8-enal?
7,8-dimethylnon-8-enal has a molecular weight of 168.28 g/mol, XLogP of 3.35, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethylnon-8-enal is sourced from PubChem (CID 89233841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).