C16H27NO — CID 89233973
(4E,6Z)-2,4-dimethyl-1-(5-methylpiperidin-3-yl)octa-4,6-dien-3-one (PubChem CID 89233973) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (4E,6Z)-2,4-dimethyl-1-(5-methylpiperidin-3-yl)octa-4,6-dien-3-one.
| Compound Name | (4E,6Z)-2,4-dimethyl-1-(5-methylpiperidin-3-yl)octa-4,6-dien-3-one |
|---|---|
| PubChem CID | 89233973 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (4E,6Z)-2,4-dimethyl-1-(5-methylpiperidin-3-yl)octa-4,6-dien-3-one |
| SMILES | C/C=C\C=C(/C)C(=O)C(C)CC1CNCC(C)C1 |
| InChI | InChI=1S/C16H27NO/c1-5-6-7-13(3)16(18)14(4)9-15-8-12(2)10-17-11-15/h5-7,12,14-15,17H,8-11H2,1-4H3/b6-5-,13-7+ |
| InChIKey | YHRFEZZZXHGWAG-RKOYKYSNSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|