C15H26F6N3O6S3- — CID 89234034
4-[di(propan-2-yl)amino]-1-[1,1,2,2,3,3-hexafluoro-3-[methyl(sulfinato)sulfamoyl]propyl]sulfonylpiperidine (PubChem CID 89234034) has the molecular formula C15H26F6N3O6S3- and a molecular weight of 554.58 g/mol. Its IUPAC name is 4-[di(propan-2-yl)amino]-1-[1,1,2,2,3,3-hexafluoro-3-[methyl(sulfinato)sulfamoyl]propyl]sulfonylpiperidine.
| Compound Name | 4-[di(propan-2-yl)amino]-1-[1,1,2,2,3,3-hexafluoro-3-[methyl(sulfinato)sulfamoyl]propyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 89234034 |
| Molecular Formula | C15H26F6N3O6S3- |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 4-[di(propan-2-yl)amino]-1-[1,1,2,2,3,3-hexafluoro-3-[methyl(sulfinato)sulfamoyl]propyl]sulfonylpiperidine |
| SMILES | CC(C)N(C(C)C)C1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N(C)S(=O)[O-])CC1 |
| InChI | InChI=1S/C15H27F6N3O6S3/c1-10(2)24(11(3)4)12-6-8-23(9-7-12)33(29,30)15(20,21)13(16,17)14(18,19)32(27,28)22(5)31(25)26/h10-12H,6-9H2,1-5H3,(H,25,26)/p-1 |
| InChIKey | FXJNTEJSLSCNOA-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|