C22H34O — CID 89234129
2-[(1E,3E,5E,7E)-9-ethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 89234129) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9-ethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9-ethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 89234129 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9-ethoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H34O/c1-7-23-17-15-19(3)11-8-10-18(2)13-14-21-20(4)12-9-16-22(21,5)6/h8,10-11,13-15H,7,9,12,16-17H2,1-6H3/b11-8+,14-13+,18-10+,19-15+ |
| InChIKey | UWQRJJVOTHDEHN-ONOWFSFQSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|