C17H26N2O4 — CID 89234181
7-[[(3E,5Z)-4-(formamidomethyl)-2-methylidenehepta-3,5-dienoyl]amino]heptanoic acid (PubChem CID 89234181) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 7-[[(3E,5Z)-4-(formamidomethyl)-2-methylidenehepta-3,5-dienoyl]amino]heptanoic acid.
| Compound Name | 7-[[(3E,5Z)-4-(formamidomethyl)-2-methylidenehepta-3,5-dienoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 89234181 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 7-[[(3E,5Z)-4-(formamidomethyl)-2-methylidenehepta-3,5-dienoyl]amino]heptanoic acid |
| SMILES | C=C(/C=C(\C=C/C)CNC=O)C(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C17H26N2O4/c1-3-8-15(12-18-13-20)11-14(2)17(23)19-10-7-5-4-6-9-16(21)22/h3,8,11,13H,2,4-7,9-10,12H2,1H3,(H,18,20)(H,19,23)(H,21,22)/b8-3-,15-11+ |
| InChIKey | LITIKHUCJUJPQJ-FIUJSHTOSA-N |
| XLogP | 1.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|