About (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol
(3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol (PubChem CID 89234744) has the molecular formula C12H26O4S
and a molecular weight of 266.40 g/mol. Its IUPAC name is (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol.
Molecular Properties
| Compound Name | (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol |
| PubChem CID | 89234744 |
| Molecular Formula | C12H26O4S |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol |
| SMILES | CO[C@H](CCSC)C(O)C(CO)[C@@H](O)C(C)C |
| InChI | InChI=1S/C12H26O4S/c1-8(2)11(14)9(7-13)12(15)10(16-3)5-6-17-4/h8-15H,5-7H2,1-4H3/t9?,10-,11+,12?/m1/s1 |
| InChIKey | MKEBEHVWCZXZBT-UPOSSJBDSA-N |
| XLogP | 0.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol?
The IUPAC name of (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol (CID 89234744) is (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol.
What is the SMILES notation for (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol?
The canonical SMILES for (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol is CO[C@H](CCSC)C(O)C(CO)[C@@H](O)C(C)C.
What is the InChIKey of (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol?
The InChIKey is MKEBEHVWCZXZBT-UPOSSJBDSA-N. The full InChI is InChI=1S/C12H26O4S/c1-8(2)11(14)9(7-13)12(15)10(16-3)5-6-17-4/h8-15H,5-7H2,1-4H3/t9?,10-,11+,12?/m1/s1.
What are the key properties of (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol?
(3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol has a molecular weight of 266.40 g/mol, XLogP of 0.74, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-4-(hydroxymethyl)-6-methoxy-2-methyl-8-methylsulfanyloctane-3,5-diol is sourced from PubChem (CID 89234744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).