About N-[(Z)-3,3-diaminoprop-1-enyl]formamide
N-[(Z)-3,3-diaminoprop-1-enyl]formamide (PubChem CID 89234839) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is N-[(Z)-3,3-diaminoprop-1-enyl]formamide.
Molecular Properties
| Compound Name | N-[(Z)-3,3-diaminoprop-1-enyl]formamide |
| PubChem CID | 89234839 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | N-[(Z)-3,3-diaminoprop-1-enyl]formamide |
| SMILES | NC(N)/C=C\NC=O |
| InChI | InChI=1S/C4H9N3O/c5-4(6)1-2-7-3-8/h1-4H,5-6H2,(H,7,8)/b2-1- |
| InChIKey | MZZJUJNPSOKOCV-UPHRSURJSA-N |
| XLogP | -1.51 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-3,3-diaminoprop-1-enyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-3,3-diaminoprop-1-enyl]formamide?
The IUPAC name of N-[(Z)-3,3-diaminoprop-1-enyl]formamide (CID 89234839) is N-[(Z)-3,3-diaminoprop-1-enyl]formamide.
What is the SMILES notation for N-[(Z)-3,3-diaminoprop-1-enyl]formamide?
The canonical SMILES for N-[(Z)-3,3-diaminoprop-1-enyl]formamide is NC(N)/C=C\NC=O.
What is the InChIKey of N-[(Z)-3,3-diaminoprop-1-enyl]formamide?
The InChIKey is MZZJUJNPSOKOCV-UPHRSURJSA-N. The full InChI is InChI=1S/C4H9N3O/c5-4(6)1-2-7-3-8/h1-4H,5-6H2,(H,7,8)/b2-1-.
What are the key properties of N-[(Z)-3,3-diaminoprop-1-enyl]formamide?
N-[(Z)-3,3-diaminoprop-1-enyl]formamide has a molecular weight of 115.14 g/mol, XLogP of -1.51, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-3,3-diaminoprop-1-enyl]formamide is sourced from PubChem (CID 89234839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).