C17H31N3S — CID 89234921
2,2-dimethyl-N-[3-(methylamino)phenyl]sulfanyl-N-(2-methylpropyl)butane-1,4-diamine (PubChem CID 89234921) has the molecular formula C17H31N3S and a molecular weight of 309.52 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-(methylamino)phenyl]sulfanyl-N-(2-methylpropyl)butane-1,4-diamine.
| Compound Name | 2,2-dimethyl-N-[3-(methylamino)phenyl]sulfanyl-N-(2-methylpropyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 89234921 |
| Molecular Formula | C17H31N3S |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2,2-dimethyl-N-[3-(methylamino)phenyl]sulfanyl-N-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CNc1cccc(SN(CC(C)C)CC(C)(C)CCN)c1 |
| InChI | InChI=1S/C17H31N3S/c1-14(2)12-20(13-17(3,4)9-10-18)21-16-8-6-7-15(11-16)19-5/h6-8,11,14,19H,9-10,12-13,18H2,1-5H3 |
| InChIKey | QYXCDIWVGJVXPH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|