About methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate
methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate (PubChem CID 89235564) has the molecular formula C9H15O4P
and a molecular weight of 218.19 g/mol. Its IUPAC name is methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate.
Molecular Properties
| Compound Name | methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate |
| PubChem CID | 89235564 |
| Molecular Formula | C9H15O4P |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate |
| SMILES | C#CC(C)(C)OP(=O)(OC)OCC=C |
| InChI | InChI=1S/C9H15O4P/c1-6-8-12-14(10,11-5)13-9(3,4)7-2/h2,6H,1,8H2,3-5H3 |
| InChIKey | MZABUDILSVFGAD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate?
The IUPAC name of methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate (CID 89235564) is methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate.
What is the SMILES notation for methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate?
The canonical SMILES for methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate is C#CC(C)(C)OP(=O)(OC)OCC=C.
What is the InChIKey of methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate?
The InChIKey is MZABUDILSVFGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15O4P/c1-6-8-12-14(10,11-5)13-9(3,4)7-2/h2,6H,1,8H2,3-5H3.
What are the key properties of methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate?
methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate has a molecular weight of 218.19 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylbut-3-yn-2-yl prop-2-enyl phosphate is sourced from PubChem (CID 89235564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).