C18H17F2N3O2 — CID 89235676
(4R)-5',5'-difluoro-2-phenylspiro[2,3-dihydrochromene-4,4'-6H-1,3-oxazine]-2',6-diamine (PubChem CID 89235676) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is (4R)-5',5'-difluoro-2-phenylspiro[2,3-dihydrochromene-4,4'-6H-1,3-oxazine]-2',6-diamine.
| Compound Name | (4R)-5',5'-difluoro-2-phenylspiro[2,3-dihydrochromene-4,4'-6H-1,3-oxazine]-2',6-diamine |
|---|---|
| PubChem CID | 89235676 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (4R)-5',5'-difluoro-2-phenylspiro[2,3-dihydrochromene-4,4'-6H-1,3-oxazine]-2',6-diamine |
| SMILES | NC1=N[C@@]2(CC(c3ccccc3)Oc3ccc(N)cc32)C(F)(F)CO1 |
| InChI | InChI=1S/C18H17F2N3O2/c19-18(20)10-24-16(22)23-17(18)9-15(11-4-2-1-3-5-11)25-14-7-6-12(21)8-13(14)17/h1-8,15H,9-10,21H2,(H2,22,23)/t15?,17-/m1/s1 |
| InChIKey | REMLDTDHYUKWQN-OMOCHNIRSA-N |
| XLogP | 2.97 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|