About 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine
4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 89235839) has the molecular formula C13H12N4OS2
and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 89235839 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1-c1sc(N)nc1-c1cnc(N)s1 |
| InChI | InChI=1S/C13H12N4OS2/c1-18-8-5-3-2-4-7(8)11-10(17-13(15)20-11)9-6-16-12(14)19-9/h2-6H,1H3,(H2,14,16)(H2,15,17) |
| InChIKey | DOCBYAUNPJEXBC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine (CID 89235839) is 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine is COc1ccccc1-c1sc(N)nc1-c1cnc(N)s1.
What is the InChIKey of 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine?
The InChIKey is DOCBYAUNPJEXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4OS2/c1-18-8-5-3-2-4-7(8)11-10(17-13(15)20-11)9-6-16-12(14)19-9/h2-6H,1H3,(H2,14,16)(H2,15,17).
What are the key properties of 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine?
4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine has a molecular weight of 304.40 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-thiazol-5-yl)-5-(2-methoxyphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 89235839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).