C18H25NO6 — CID 89236066
[(3aR,4S,6R,6aS)-4-[2-[dideuterio-(2,3-dideuteriophenyl)methoxy]ethoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamic acid (PubChem CID 89236066) has the molecular formula C18H25NO6 and a molecular weight of 355.42 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-4-[2-[dideuterio-(2,3-dideuteriophenyl)methoxy]ethoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamic acid.
| Compound Name | [(3aR,4S,6R,6aS)-4-[2-[dideuterio-(2,3-dideuteriophenyl)methoxy]ethoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamic acid |
|---|---|
| PubChem CID | 89236066 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(3aR,4S,6R,6aS)-4-[2-[dideuterio-(2,3-dideuteriophenyl)methoxy]ethoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamic acid |
| SMILES | [2H]c1cccc(C([2H])([2H])OCCO[C@H]2C[C@@H](NC(=O)O)[C@@H]3OC(C)(C)O[C@@H]32)c1[2H] |
| InChI | InChI=1S/C18H25NO6/c1-18(2)24-15-13(19-17(20)21)10-14(16(15)25-18)23-9-8-22-11-12-6-4-3-5-7-12/h3-7,13-16,19H,8-11H2,1-2H3,(H,20,21)/t13-,14+,15+,16-/m1/s1/i4D,6D,11D2 |
| InChIKey | OUQAAXARFIFBDV-CTKJCLTQSA-N |
| XLogP | 2.15 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|