C14H19F4NaO3S — CID 89236166
sodium 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonate (PubChem CID 89236166) has the molecular formula C14H19F4NaO3S and a molecular weight of 366.35 g/mol. Its IUPAC name is sodium 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonate.
| Compound Name | sodium 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 89236166 |
| Molecular Formula | C14H19F4NaO3S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | sodium 1-(1-adamantyl)-3,3,4,4-tetrafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(CC(F)(F)C(F)F)C12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C14H20F4O3S.Na/c15-12(16)14(17,18)7-11(22(19,20)21)13-4-8-1-9(5-13)3-10(2-8)6-13;/h8-12H,1-7H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | GNHYZQNWKBTFIF-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|