About N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide
N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide (PubChem CID 89236259) has the molecular formula C14H17N3O4S2
and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide |
| PubChem CID | 89236259 |
| Molecular Formula | C14H17N3O4S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCN(C)S(=O)(=O)c1ccc(-c2ccno2)s1 |
| InChI | InChI=1S/C14H17N3O4S2/c1-3-13(18)15-8-4-10-17(2)23(19,20)14-6-5-12(22-14)11-7-9-16-21-11/h3,5-7,9H,1,4,8,10H2,2H3,(H,15,18) |
| InChIKey | HHQJCMDWKADVFD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide?
The IUPAC name of N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide (CID 89236259) is N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide.
What is the SMILES notation for N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide?
The canonical SMILES for N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide is C=CC(=O)NCCCN(C)S(=O)(=O)c1ccc(-c2ccno2)s1.
What is the InChIKey of N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide?
The InChIKey is HHQJCMDWKADVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4S2/c1-3-13(18)15-8-4-10-17(2)23(19,20)14-6-5-12(22-14)11-7-9-16-21-11/h3,5-7,9H,1,4,8,10H2,2H3,(H,15,18).
What are the key properties of N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide?
N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide has a molecular weight of 355.44 g/mol, XLogP of 1.72, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[methyl-[5-(1,2-oxazol-5-yl)thiophen-2-yl]sulfonylamino]propyl]prop-2-enamide is sourced from PubChem (CID 89236259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).