About naphthalene;trimethylazanium;chloride
naphthalene;trimethylazanium;chloride (PubChem CID 89236308) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is naphthalene;trimethylazanium;chloride.
Molecular Properties
| Compound Name | naphthalene;trimethylazanium;chloride |
| PubChem CID | 89236308 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | naphthalene;trimethylazanium;chloride |
| SMILES | C[NH+](C)C.[Cl-].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H9N.ClH/c1-2-6-10-8-4-3-7-9(10)5-1;1-4(2)3;/h1-8H;1-3H3;1H |
| InChIKey | PNWHINIZIOWFEQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze naphthalene;trimethylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;trimethylazanium;chloride?
The IUPAC name of naphthalene;trimethylazanium;chloride (CID 89236308) is naphthalene;trimethylazanium;chloride.
What is the SMILES notation for naphthalene;trimethylazanium;chloride?
The canonical SMILES for naphthalene;trimethylazanium;chloride is C[NH+](C)C.[Cl-].c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;trimethylazanium;chloride?
The InChIKey is PNWHINIZIOWFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C3H9N.ClH/c1-2-6-10-8-4-3-7-9(10)5-1;1-4(2)3;/h1-8H;1-3H3;1H.
What are the key properties of naphthalene;trimethylazanium;chloride?
naphthalene;trimethylazanium;chloride has a molecular weight of 223.75 g/mol, XLogP of -1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;trimethylazanium;chloride is sourced from PubChem (CID 89236308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).